C8H10FNO — CID 143720354
(2E)-2-(C,N-dimethylcarbonimidoyl)-4-fluoropenta-2,4-dienal (PubChem CID 143720354) has the molecular formula C8H10FNO and a molecular weight of 155.17 g/mol. Its IUPAC name is (2E)-2-(C,N-dimethylcarbonimidoyl)-4-fluoropenta-2,4-dienal.
| Compound Name | (2E)-2-(C,N-dimethylcarbonimidoyl)-4-fluoropenta-2,4-dienal |
|---|---|
| PubChem CID | 143720354 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | (2E)-2-(C,N-dimethylcarbonimidoyl)-4-fluoropenta-2,4-dienal |
| SMILES | C=C(F)/C=C(C=O)\C(C)=N\C |
| InChI | InChI=1S/C8H10FNO/c1-6(9)4-8(5-11)7(2)10-3/h4-5H,1H2,2-3H3/b8-4-,10-7+ |
| InChIKey | DDEOLCFKEHCDSL-WULZKXQJSA-N |
| XLogP | 1.69 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|