C11H13NO — CID 142071750
(5Z)-6-methylimino-5-propylidenecyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 142071750) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is (5Z)-6-methylimino-5-propylidenecyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | (5Z)-6-methylimino-5-propylidenecyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 142071750 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (5Z)-6-methylimino-5-propylidenecyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC/C=C1/C=CC=C(C=O)/C1=N\C |
| InChI | InChI=1S/C11H13NO/c1-3-5-9-6-4-7-10(8-13)11(9)12-2/h4-8H,3H2,1-2H3/b9-5-,12-11- |
| InChIKey | VVGJMCLEFUABFM-KUKIXKHNSA-N |
| XLogP | 2.09 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|