C11H13NO — CID 91243948
3-(4-ethyliminocyclohexa-1,5-dien-1-yl)prop-2-enal (PubChem CID 91243948) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-(4-ethyliminocyclohexa-1,5-dien-1-yl)prop-2-enal.
| Compound Name | 3-(4-ethyliminocyclohexa-1,5-dien-1-yl)prop-2-enal |
|---|---|
| PubChem CID | 91243948 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-(4-ethyliminocyclohexa-1,5-dien-1-yl)prop-2-enal |
| SMILES | CC/N=C1/C=CC(C=CC=O)=CC1 |
| InChI | InChI=1S/C11H13NO/c1-2-12-11-7-5-10(6-8-11)4-3-9-13/h3-7,9H,2,8H2,1H3/b4-3?,12-11- |
| InChIKey | ODLYZZLKZJKIEX-DRUZXFPZSA-N |
| XLogP | 2.09 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|