C9H9NO2 — CID 141161251
N-(4-formylcyclohexa-2,4-dien-1-ylidene)acetamide (PubChem CID 141161251) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is N-(4-formylcyclohexa-2,4-dien-1-ylidene)acetamide.
| Compound Name | N-(4-formylcyclohexa-2,4-dien-1-ylidene)acetamide |
|---|---|
| PubChem CID | 141161251 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | N-(4-formylcyclohexa-2,4-dien-1-ylidene)acetamide |
| SMILES | CC(=O)/N=C1/C=CC(C=O)=CC1 |
| InChI | InChI=1S/C9H9NO2/c1-7(12)10-9-4-2-8(6-11)3-5-9/h2-4,6H,5H2,1H3/b10-9- |
| InChIKey | SWWCCULIGUJRAR-KTKRTIGZSA-N |
| XLogP | 1.06 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|