C14H21NO — CID 162444125
ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine-2-carbaldehyde;methane (PubChem CID 162444125) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine-2-carbaldehyde;methane.
| Compound Name | ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine-2-carbaldehyde;methane |
|---|---|
| PubChem CID | 162444125 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | ethane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine-2-carbaldehyde;methane |
| SMILES | C.C=C/C=c1/c(C=O)ncc/c1=C/C.CC |
| InChI | InChI=1S/C11H11NO.C2H6.CH4/c1-3-5-10-9(4-2)6-7-12-11(10)8-13;1-2;/h3-8H,1H2,2H3;1-2H3;1H4/b9-4-,10-5+;; |
| InChIKey | ZWVFHOQLLQZPLZ-ASQDCFOUSA-N |
| XLogP | 2.32 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|