C8H11F2NO — CID 155718501
(E)-5,5-difluoro-2-methyl-4-methyliminohex-2-enal (PubChem CID 155718501) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is (E)-5,5-difluoro-2-methyl-4-methyliminohex-2-enal.
| Compound Name | (E)-5,5-difluoro-2-methyl-4-methyliminohex-2-enal |
|---|---|
| PubChem CID | 155718501 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (E)-5,5-difluoro-2-methyl-4-methyliminohex-2-enal |
| SMILES | C/N=C(\C=C(/C)C=O)C(C)(F)F |
| InChI | InChI=1S/C8H11F2NO/c1-6(5-12)4-7(11-3)8(2,9)10/h4-5H,1-3H3/b6-4+,11-7+ |
| InChIKey | QQORGUHGECXOBT-RQBRCHNQSA-N |
| XLogP | 1.86 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|