C10H15NO — CID 171811389
(3Z)-4-methyl-2-propyliminohexa-3,5-dienal (PubChem CID 171811389) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3Z)-4-methyl-2-propyliminohexa-3,5-dienal.
| Compound Name | (3Z)-4-methyl-2-propyliminohexa-3,5-dienal |
|---|---|
| PubChem CID | 171811389 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3Z)-4-methyl-2-propyliminohexa-3,5-dienal |
| SMILES | C=C/C(C)=C\C(C=O)=N\CCC |
| InChI | InChI=1S/C10H15NO/c1-4-6-11-10(8-12)7-9(3)5-2/h5,7-8H,2,4,6H2,1,3H3/b9-7-,11-10- |
| InChIKey | IZSRQEYUUQZOBV-MNAJIYKBSA-N |
| XLogP | 2.17 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|