C11H15NO — CID 91282011
8-propan-2-yliminoocta-3,5,6-trienal (PubChem CID 91282011) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 8-propan-2-yliminoocta-3,5,6-trienal.
| Compound Name | 8-propan-2-yliminoocta-3,5,6-trienal |
|---|---|
| PubChem CID | 91282011 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 8-propan-2-yliminoocta-3,5,6-trienal |
| SMILES | CC(C)/N=C/C=C=CC=CCC=O |
| InChI | InChI=1S/C11H15NO/c1-11(2)12-9-7-5-3-4-6-8-10-13/h3-4,6-7,9-11H,8H2,1-2H3/b6-4?,12-9+ |
| InChIKey | FZFPBOHGSDGNBY-GLNVPWRBSA-N |
| XLogP | 2.32 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|