C9H12NO+ — CID 123751970
acetyl-(3-methylcyclohexa-2,4-dien-1-ylidene)azanium (PubChem CID 123751970) has the molecular formula C9H12NO+ and a molecular weight of 150.20 g/mol. Its IUPAC name is acetyl-(3-methylcyclohexa-2,4-dien-1-ylidene)azanium.
| Compound Name | acetyl-(3-methylcyclohexa-2,4-dien-1-ylidene)azanium |
|---|---|
| PubChem CID | 123751970 |
| Molecular Formula | C9H12NO+ |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | acetyl-(3-methylcyclohexa-2,4-dien-1-ylidene)azanium |
| SMILES | CC(=O)/[NH+]=C1/C=C(C)C=CC1 |
| InChI | InChI=1S/C9H11NO/c1-7-4-3-5-9(6-7)10-8(2)11/h3-4,6H,5H2,1-2H3/p+1/b10-9+ |
| InChIKey | STIISTILIGAVDT-MDZDMXLPSA-O |
| XLogP | -0.04 |
| TPSA | 31.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|