About acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium
acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium (PubChem CID 59850016) has the molecular formula C9H9FNO+
and a molecular weight of 166.17 g/mol. Its IUPAC name is acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium.
Molecular Properties
| Compound Name | acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium |
| PubChem CID | 59850016 |
| Molecular Formula | C9H9FNO+ |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium |
| SMILES | C=C1C=C/C(=[NH+]\C(C)=O)C(F)=C1 |
| InChI | InChI=1S/C9H8FNO/c1-6-3-4-9(8(10)5-6)11-7(2)12/h3-5H,1H2,2H3/p+1/b11-9+ |
| InChIKey | QWORESCEAPYPDD-PKNBQFBNSA-O |
| XLogP | 0.03 |
| TPSA | 31.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium?
The IUPAC name of acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium (CID 59850016) is acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium.
What is the SMILES notation for acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium?
The canonical SMILES for acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium is C=C1C=C/C(=[NH+]\C(C)=O)C(F)=C1.
What is the InChIKey of acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium?
The InChIKey is QWORESCEAPYPDD-PKNBQFBNSA-O. The full InChI is InChI=1S/C9H8FNO/c1-6-3-4-9(8(10)5-6)11-7(2)12/h3-5H,1H2,2H3/p+1/b11-9+.
What are the key properties of acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium?
acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium has a molecular weight of 166.17 g/mol, XLogP of 0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)azanium is sourced from PubChem (CID 59850016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).