C9H8FNO — CID 59850017
N-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)acetamide (PubChem CID 59850017) has the molecular formula C9H8FNO and a molecular weight of 165.17 g/mol. Its IUPAC name is N-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)acetamide.
| Compound Name | N-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)acetamide |
|---|---|
| PubChem CID | 59850017 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | N-(2-fluoro-4-methylidenecyclohexa-2,5-dien-1-ylidene)acetamide |
| SMILES | C=C1C=C/C(=N\C(C)=O)C(F)=C1 |
| InChI | InChI=1S/C9H8FNO/c1-6-3-4-9(8(10)5-6)11-7(2)12/h3-5H,1H2,2H3/b11-9+ |
| InChIKey | QWORESCEAPYPDD-PKNBQFBNSA-N |
| XLogP | 1.95 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|