C8H8NO+ — CID 163439372
(4-methylcyclohexa-2,4-dien-1-ylidene)-(oxomethylidene)azanium (PubChem CID 163439372) has the molecular formula C8H8NO+ and a molecular weight of 134.16 g/mol. Its IUPAC name is (4-methylcyclohexa-2,4-dien-1-ylidene)-(oxomethylidene)azanium.
| Compound Name | (4-methylcyclohexa-2,4-dien-1-ylidene)-(oxomethylidene)azanium |
|---|---|
| PubChem CID | 163439372 |
| Molecular Formula | C8H8NO+ |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | (4-methylcyclohexa-2,4-dien-1-ylidene)-(oxomethylidene)azanium |
| SMILES | CC1=CCC(=[N+]=C=O)C=C1 |
| InChI | InChI=1S/C8H8NO/c1-7-2-4-8(5-3-7)9-6-10/h2-4H,5H2,1H3/q+1 |
| InChIKey | LNMHFCIDFSGNQB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 31.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|