C14H13N2O+ — CID 100952885
[4-(4-acetyliminocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 100952885) has the molecular formula C14H13N2O+ and a molecular weight of 225.27 g/mol. Its IUPAC name is [4-(4-acetyliminocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | [4-(4-acetyliminocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 100952885 |
| Molecular Formula | C14H13N2O+ |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | [4-(4-acetyliminocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CC(=O)N=C1C=CC(=C2C=CC(=[NH2+])C=C2)C=C1 |
| InChI | InChI=1S/C14H12N2O/c1-10(17)16-14-8-4-12(5-9-14)11-2-6-13(15)7-3-11/h2-9,15H,1H3/p+1/b12-11-,15-13?,16-14- |
| InChIKey | UFGHOEVTEIKPCF-ABUMBURPSA-O |
| XLogP | 0.72 |
| TPSA | 55.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|