C17H17N2O+ — CID 100945645
acetyl-[4-[2-(4-iminocyclohexa-2,5-dien-1-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-methylazanium (PubChem CID 100945645) has the molecular formula C17H17N2O+ and a molecular weight of 265.34 g/mol. Its IUPAC name is acetyl-[4-[2-(4-iminocyclohexa-2,5-dien-1-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-methylazanium.
| Compound Name | acetyl-[4-[2-(4-iminocyclohexa-2,5-dien-1-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-methylazanium |
|---|---|
| PubChem CID | 100945645 |
| Molecular Formula | C17H17N2O+ |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | acetyl-[4-[2-(4-iminocyclohexa-2,5-dien-1-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-methylazanium |
| SMILES | [H]N=C1C=CC(=CC=C2C=CC(=[N+](C)C(C)=O)C=C2)C=C1 |
| InChI | InChI=1S/C17H17N2O/c1-13(20)19(2)17-11-7-15(8-12-17)4-3-14-5-9-16(18)10-6-14/h3-12,18H,1-2H3/q+1/b14-3-,15-4-,18-16+,19-17- |
| InChIKey | STKOSNYSYBENLW-GYFYFPSUSA-N |
| XLogP | 2.74 |
| TPSA | 43.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|