C16H17IN2O — CID 171377091
N-[4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]acetamide;hydroiodide (PubChem CID 171377091) has the molecular formula C16H17IN2O and a molecular weight of 380.23 g/mol. Its IUPAC name is N-[4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]acetamide;hydroiodide.
| Compound Name | N-[4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]acetamide;hydroiodide |
|---|---|
| PubChem CID | 171377091 |
| Molecular Formula | C16H17IN2O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | N-[4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]acetamide;hydroiodide |
| SMILES | CC(=O)N=C1C=CC(=CC=C2C=CN(C)C=C2)C=C1.I |
| InChI | InChI=1S/C16H16N2O.HI/c1-13(19)17-16-7-5-14(6-8-16)3-4-15-9-11-18(2)12-10-15;/h3-12H,1-2H3;1H/b14-3-,17-16+; |
| InChIKey | AGUMEGBGJGQVLP-UJMYPQIOSA-N |
| XLogP | 3.54 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|