C18H18N2O — CID 126419248
N-[4-[(2Z)-2-(1-prop-2-enyl-2-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]acetamide (PubChem CID 126419248) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[4-[(2Z)-2-(1-prop-2-enyl-2-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]acetamide.
| Compound Name | N-[4-[(2Z)-2-(1-prop-2-enyl-2-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]acetamide |
|---|---|
| PubChem CID | 126419248 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[4-[(2Z)-2-(1-prop-2-enyl-2-pyridinylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]acetamide |
| SMILES | C=CCN1C=CC=C/C1=C/C=C1C=CC(=NC(C)=O)C=C1 |
| InChI | InChI=1S/C18H18N2O/c1-3-13-20-14-5-4-6-18(20)12-9-16-7-10-17(11-8-16)19-15(2)21/h3-12,14H,1,13H2,2H3/b16-9-,18-12-,19-17+ |
| InChIKey | BBIUZTIRLBFWSF-BNVVSUBGSA-N |
| XLogP | 3.48 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|