C16H18N2O — CID 101358952
N-[3,5-dimethyl-4-(1-methyl-4-pyridinylidene)cyclohexa-2,5-dien-1-ylidene]acetamide (PubChem CID 101358952) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is N-[3,5-dimethyl-4-(1-methyl-4-pyridinylidene)cyclohexa-2,5-dien-1-ylidene]acetamide.
| Compound Name | N-[3,5-dimethyl-4-(1-methyl-4-pyridinylidene)cyclohexa-2,5-dien-1-ylidene]acetamide |
|---|---|
| PubChem CID | 101358952 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-[3,5-dimethyl-4-(1-methyl-4-pyridinylidene)cyclohexa-2,5-dien-1-ylidene]acetamide |
| SMILES | CC(=O)N=C1C=C(C)C(=C2C=CN(C)C=C2)C(C)=C1 |
| InChI | InChI=1S/C16H18N2O/c1-11-9-15(17-13(3)19)10-12(2)16(11)14-5-7-18(4)8-6-14/h5-10H,1-4H3 |
| InChIKey | USHVTFMMZYSZNI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|