C16H16N2O — CID 143037792
3-cyclopenta-1,3-dien-1-yl-7-methyl-2,7-naphthyridin-1-one;ethene (PubChem CID 143037792) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-cyclopenta-1,3-dien-1-yl-7-methyl-2,7-naphthyridin-1-one;ethene.
| Compound Name | 3-cyclopenta-1,3-dien-1-yl-7-methyl-2,7-naphthyridin-1-one;ethene |
|---|---|
| PubChem CID | 143037792 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-cyclopenta-1,3-dien-1-yl-7-methyl-2,7-naphthyridin-1-one;ethene |
| SMILES | C=C.Cn1ccc2cc(C3=CC=CC3)nc(=O)c-2c1 |
| InChI | InChI=1S/C14H12N2O.C2H4/c1-16-7-6-11-8-13(10-4-2-3-5-10)15-14(17)12(11)9-16;1-2/h2-4,6-9H,5H2,1H3;1-2H2 |
| InChIKey | KBYWHLCWHCTYMD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|