C15H14N2O — CID 143037796
3-cyclohexa-2,4-dien-1-yl-7-methyl-2,7-naphthyridin-1-one (PubChem CID 143037796) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-cyclohexa-2,4-dien-1-yl-7-methyl-2,7-naphthyridin-1-one.
| Compound Name | 3-cyclohexa-2,4-dien-1-yl-7-methyl-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 143037796 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-cyclohexa-2,4-dien-1-yl-7-methyl-2,7-naphthyridin-1-one |
| SMILES | Cn1ccc2cc(C3C=CC=CC3)nc(=O)c-2c1 |
| InChI | InChI=1S/C15H14N2O/c1-17-8-7-12-9-14(11-5-3-2-4-6-11)16-15(18)13(12)10-17/h2-5,7-11H,6H2,1H3 |
| InChIKey | XVQUREKDDYXZNL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |