C12H8N2O2 — CID 10081894
3-hydroxybenzo[c][2,7]naphthyridin-5-one (PubChem CID 10081894) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-hydroxybenzo[c][2,7]naphthyridin-5-one.
| Compound Name | 3-hydroxybenzo[c][2,7]naphthyridin-5-one |
|---|---|
| PubChem CID | 10081894 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-hydroxybenzo[c][2,7]naphthyridin-5-one |
| SMILES | O=c1nc2ccccc2c2ccn(O)cc1-2 |
| InChI | InChI=1S/C12H8N2O2/c15-12-10-7-14(16)6-5-8(10)9-3-1-2-4-11(9)13-12/h1-7,16H |
| InChIKey | UDYYVVBFCALNLE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|