C10H11ClN2O — CID 121215745
3,7-dimethyl-2,7-naphthyridin-1-one;hydrochloride (PubChem CID 121215745) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is 3,7-dimethyl-2,7-naphthyridin-1-one;hydrochloride.
| Compound Name | 3,7-dimethyl-2,7-naphthyridin-1-one;hydrochloride |
|---|---|
| PubChem CID | 121215745 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3,7-dimethyl-2,7-naphthyridin-1-one;hydrochloride |
| SMILES | Cc1cc2ccn(C)cc-2c(=O)n1.Cl |
| InChI | InChI=1S/C10H10N2O.ClH/c1-7-5-8-3-4-12(2)6-9(8)10(13)11-7;/h3-6H,1-2H3;1H |
| InChIKey | PHVZRBKLJRIDQO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |