C14H11N3O — CID 172683681
pyrido[2,1-c][1,4]benzodiazepine-9-carboxamide (PubChem CID 172683681) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is pyrido[2,1-c][1,4]benzodiazepine-9-carboxamide.
| Compound Name | pyrido[2,1-c][1,4]benzodiazepine-9-carboxamide |
|---|---|
| PubChem CID | 172683681 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | pyrido[2,1-c][1,4]benzodiazepine-9-carboxamide |
| SMILES | NC(=O)C1=CN2C=c3ccccc3=NC=C2C=C1 |
| InChI | InChI=1S/C14H11N3O/c15-14(18)11-5-6-12-7-16-13-4-2-1-3-10(13)8-17(12)9-11/h1-9H,(H2,15,18) |
| InChIKey | ASZUGLCLRCGEAA-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |