C13H11N3O — CID 67435726
7H-pyrrolo[2,1-c][1,4]benzodiazepine-3-carboxamide (PubChem CID 67435726) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 7H-pyrrolo[2,1-c][1,4]benzodiazepine-3-carboxamide.
| Compound Name | 7H-pyrrolo[2,1-c][1,4]benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 67435726 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 7H-pyrrolo[2,1-c][1,4]benzodiazepine-3-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)=NC=C1CC=CN1C=2 |
| InChI | InChI=1S/C13H11N3O/c14-13(17)9-3-4-10-8-16-5-1-2-11(16)7-15-12(10)6-9/h1,3-8H,2H2,(H2,14,17) |
| InChIKey | DYCGERURMPDTQC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |