C9H14N2O — CID 123593160
[(3Z)-5-methylhepta-3,5-dien-2-ylidene]urea (PubChem CID 123593160) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is [(3Z)-5-methylhepta-3,5-dien-2-ylidene]urea.
| Compound Name | [(3Z)-5-methylhepta-3,5-dien-2-ylidene]urea |
|---|---|
| PubChem CID | 123593160 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | [(3Z)-5-methylhepta-3,5-dien-2-ylidene]urea |
| SMILES | CC=C(C)/C=C\C(C)=NC(N)=O |
| InChI | InChI=1S/C9H14N2O/c1-4-7(2)5-6-8(3)11-9(10)12/h4-6H,1-3H3,(H2,10,12)/b6-5-,7-4?,11-8? |
| InChIKey | IBWLJHGZJIPUFP-IJMSXMRTSA-N |
| XLogP | 2.05 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|