About [(3Z)-hepta-3,5-dien-2-ylidene]urea
[(3Z)-hepta-3,5-dien-2-ylidene]urea (PubChem CID 123901556) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is [(3Z)-hepta-3,5-dien-2-ylidene]urea.
Molecular Properties
| Compound Name | [(3Z)-hepta-3,5-dien-2-ylidene]urea |
| PubChem CID | 123901556 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | [(3Z)-hepta-3,5-dien-2-ylidene]urea |
| SMILES | CC=C/C=C\C(C)=NC(N)=O |
| InChI | InChI=1S/C8H12N2O/c1-3-4-5-6-7(2)10-8(9)11/h3-6H,1-2H3,(H2,9,11)/b4-3?,6-5-,10-7? |
| InChIKey | IFBUKNMRVNIHEV-VAVRASFNSA-N |
| XLogP | 1.66 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-hepta-3,5-dien-2-ylidene]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-hepta-3,5-dien-2-ylidene]urea?
The IUPAC name of [(3Z)-hepta-3,5-dien-2-ylidene]urea (CID 123901556) is [(3Z)-hepta-3,5-dien-2-ylidene]urea.
What is the SMILES notation for [(3Z)-hepta-3,5-dien-2-ylidene]urea?
The canonical SMILES for [(3Z)-hepta-3,5-dien-2-ylidene]urea is CC=C/C=C\C(C)=NC(N)=O.
What is the InChIKey of [(3Z)-hepta-3,5-dien-2-ylidene]urea?
The InChIKey is IFBUKNMRVNIHEV-VAVRASFNSA-N. The full InChI is InChI=1S/C8H12N2O/c1-3-4-5-6-7(2)10-8(9)11/h3-6H,1-2H3,(H2,9,11)/b4-3?,6-5-,10-7?.
What are the key properties of [(3Z)-hepta-3,5-dien-2-ylidene]urea?
[(3Z)-hepta-3,5-dien-2-ylidene]urea has a molecular weight of 152.20 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-hepta-3,5-dien-2-ylidene]urea is sourced from PubChem (CID 123901556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).