About benzimidazol-2-one;butane
benzimidazol-2-one;butane (PubChem CID 163443931) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is benzimidazol-2-one;butane.
Molecular Properties
| Compound Name | benzimidazol-2-one;butane |
| PubChem CID | 163443931 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | benzimidazol-2-one;butane |
| SMILES | CCCC.O=C1N=c2ccccc2=N1 |
| InChI | InChI=1S/C7H4N2O.C4H10/c10-7-8-5-3-1-2-4-6(5)9-7;1-3-4-2/h1-4H;3-4H2,1-2H3 |
| InChIKey | BAWWXVFNSXXVJR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzimidazol-2-one;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzimidazol-2-one;butane?
The IUPAC name of benzimidazol-2-one;butane (CID 163443931) is benzimidazol-2-one;butane.
What is the SMILES notation for benzimidazol-2-one;butane?
The canonical SMILES for benzimidazol-2-one;butane is CCCC.O=C1N=c2ccccc2=N1.
What is the InChIKey of benzimidazol-2-one;butane?
The InChIKey is BAWWXVFNSXXVJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O.C4H10/c10-7-8-5-3-1-2-4-6(5)9-7;1-3-4-2/h1-4H;3-4H2,1-2H3.
What are the key properties of benzimidazol-2-one;butane?
benzimidazol-2-one;butane has a molecular weight of 190.25 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzimidazol-2-one;butane is sourced from PubChem (CID 163443931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).