C16H14NO+ — CID 136680457
N-[4-(2-cyclohexa-2,4-dien-1-ylideneethylidene)cyclohexa-2,5-dien-1-ylidene]acetamide (PubChem CID 136680457) has the molecular formula C16H14NO+ and a molecular weight of 236.29 g/mol. Its IUPAC name is N-[4-(2-cyclohexa-2,4-dien-1-ylideneethylidene)cyclohexa-2,5-dien-1-ylidene]acetamide.
| Compound Name | N-[4-(2-cyclohexa-2,4-dien-1-ylideneethylidene)cyclohexa-2,5-dien-1-ylidene]acetamide |
|---|---|
| PubChem CID | 136680457 |
| Molecular Formula | C16H14NO+ |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | N-[4-(2-cyclohexa-2,4-dien-1-ylideneethylidene)cyclohexa-2,5-dien-1-ylidene]acetamide |
| SMILES | CC(=O)N=C1C=CC(=CC=C2C=CC=C[CH+]2)C=C1 |
| InChI | InChI=1S/C16H14NO/c1-13(18)17-16-11-9-15(10-12-16)8-7-14-5-3-2-4-6-14/h2-12H,1H3/q+1/b15-8-,17-16+ |
| InChIKey | YCGOXXPDVYOGAZ-DZJDTMBMSA-N |
| XLogP | 3.28 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|