C19H25BN4O2 — CID 145459788
CID 145459788 (PubChem CID 145459788) has the molecular formula C19H25BN4O2 and a molecular weight of 352.25 g/mol.
| Compound Name | CID 145459788 |
|---|---|
| PubChem CID | 145459788 |
| Molecular Formula | C19H25BN4O2 |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | — |
| SMILES | [B]c1cccc([C@H]2N=C(N)N(CC3CCN(C(C)=O)C3)C(=O)C2(C)C)c1 |
| InChI | InChI=1S/C19H25BN4O2/c1-12(25)23-8-7-13(10-23)11-24-17(26)19(2,3)16(22-18(24)21)14-5-4-6-15(20)9-14/h4-6,9,13,16H,7-8,10-11H2,1-3H3,(H2,21,22)/t13?,16-/m1/s1 |
| InChIKey | UJJVAJSZPOPHHP-FQNRMIAFSA-N |
| XLogP | 0.57 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|