C24H26ClN3O2 — CID 59388176
1-[[(3R)-1-acetylpyrrolidin-3-yl]methyl]-3-[3-(3-chlorophenyl)phenyl]-5-imino-3-methylpyrrolidin-2-one (PubChem CID 59388176) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is 1-[[(3R)-1-acetylpyrrolidin-3-yl]methyl]-3-[3-(3-chlorophenyl)phenyl]-5-imino-3-methylpyrrolidin-2-one.
| Compound Name | 1-[[(3R)-1-acetylpyrrolidin-3-yl]methyl]-3-[3-(3-chlorophenyl)phenyl]-5-imino-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 59388176 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[[(3R)-1-acetylpyrrolidin-3-yl]methyl]-3-[3-(3-chlorophenyl)phenyl]-5-imino-3-methylpyrrolidin-2-one |
| SMILES | [H]/N=C1\CC(C)(c2cccc(-c3cccc(Cl)c3)c2)C(=O)N1C[C@@H]1CCN(C(C)=O)C1 |
| InChI | InChI=1S/C24H26ClN3O2/c1-16(29)27-10-9-17(14-27)15-28-22(26)13-24(2,23(28)30)20-7-3-5-18(11-20)19-6-4-8-21(25)12-19/h3-8,11-12,17,26H,9-10,13-15H2,1-2H3/b26-22+/t17-,24?/m1/s1 |
| InChIKey | KVQZUWREXRZMEK-TXKBSCROSA-N |
| XLogP | 4.34 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|