C25H26N2O — CID 145460405
2,2-dimethyl-5,5-diphenyl-3-(2-phenylethyl)imidazolidin-4-one (PubChem CID 145460405) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is 2,2-dimethyl-5,5-diphenyl-3-(2-phenylethyl)imidazolidin-4-one.
| Compound Name | 2,2-dimethyl-5,5-diphenyl-3-(2-phenylethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 145460405 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2,2-dimethyl-5,5-diphenyl-3-(2-phenylethyl)imidazolidin-4-one |
| SMILES | CC1(C)NC(c2ccccc2)(c2ccccc2)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C25H26N2O/c1-24(2)26-25(21-14-8-4-9-15-21,22-16-10-5-11-17-22)23(28)27(24)19-18-20-12-6-3-7-13-20/h3-17,26H,18-19H2,1-2H3 |
| InChIKey | RIVGKQJCSYNKSU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |