C23H18Cl2N2OS — CID 11408073
5,5-bis(4-chlorophenyl)-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 11408073) has the molecular formula C23H18Cl2N2OS and a molecular weight of 441.38 g/mol. Its IUPAC name is 5,5-bis(4-chlorophenyl)-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5,5-bis(4-chlorophenyl)-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 11408073 |
| Molecular Formula | C23H18Cl2N2OS |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 5,5-bis(4-chlorophenyl)-3-(2-phenylethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1N(CCc2ccccc2)C(=S)NC1(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18Cl2N2OS/c24-19-10-6-17(7-11-19)23(18-8-12-20(25)13-9-18)21(28)27(22(29)26-23)15-14-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,26,29) |
| InChIKey | RPVFNXLVQVHDAD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|