About N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide
N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide (PubChem CID 11199004) has the molecular formula C19H19N3O2S
and a molecular weight of 353.45 g/mol. Its IUPAC name is N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide |
| PubChem CID | 11199004 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide |
| SMILES | CN(C)C(=O)CN1C(=O)C(c2ccccc2)(c2ccccc2)NC1=S |
| InChI | InChI=1S/C19H19N3O2S/c1-21(2)16(23)13-22-17(24)19(20-18(22)25,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H,20,25) |
| InChIKey | LONZJJYKQAAHDS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide?
The IUPAC name of N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide (CID 11199004) is N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide.
What is the SMILES notation for N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide?
The canonical SMILES for N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide is CN(C)C(=O)CN1C(=O)C(c2ccccc2)(c2ccccc2)NC1=S.
What is the InChIKey of N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide?
The InChIKey is LONZJJYKQAAHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O2S/c1-21(2)16(23)13-22-17(24)19(20-18(22)25,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H,20,25).
What are the key properties of N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide?
N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide has a molecular weight of 353.45 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(5-oxo-4,4-diphenyl-2-sulfanylideneimidazolidin-1-yl)acetamide is sourced from PubChem (CID 11199004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).