About 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol
2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol (PubChem CID 145460624) has the molecular formula C20H40N2O3
and a molecular weight of 356.55 g/mol. Its IUPAC name is 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol.
Molecular Properties
| Compound Name | 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol |
| PubChem CID | 145460624 |
| Molecular Formula | C20H40N2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.30 |
| IUPAC Name | 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol |
| SMILES | C=C(NC(C=O)(CCCC)CCCC)N(C)CCCCCC=O.CO |
| InChI | InChI=1S/C19H36N2O2.CH4O/c1-5-7-13-19(17-23,14-8-6-2)20-18(3)21(4)15-11-9-10-12-16-22;1-2/h16-17,20H,3,5-15H2,1-2,4H3;2H,1H3 |
| InChIKey | ASRYWWTXZKHCIE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol?
The IUPAC name of 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol (CID 145460624) is 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol.
What is the SMILES notation for 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol?
The canonical SMILES for 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol is C=C(NC(C=O)(CCCC)CCCC)N(C)CCCCCC=O.CO.
What is the InChIKey of 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol?
The InChIKey is ASRYWWTXZKHCIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36N2O2.CH4O/c1-5-7-13-19(17-23,14-8-6-2)20-18(3)21(4)15-11-9-10-12-16-22;1-2/h16-17,20H,3,5-15H2,1-2,4H3;2H,1H3.
What are the key properties of 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol?
2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol has a molecular weight of 356.55 g/mol, XLogP of 3.66, 16 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-2-[1-[methyl(6-oxohexyl)amino]ethenylamino]hexanal;methanol is sourced from PubChem (CID 145460624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).