C24H49N3O2 — CID 145460249
ethane;6-[[(Z)-1-(5-formylnonan-5-ylamino)but-1-enyl]-methylamino]-N-methylhexanamide (PubChem CID 145460249) has the molecular formula C24H49N3O2 and a molecular weight of 411.68 g/mol. Its IUPAC name is ethane;6-[[(Z)-1-(5-formylnonan-5-ylamino)but-1-enyl]-methylamino]-N-methylhexanamide.
| Compound Name | ethane;6-[[(Z)-1-(5-formylnonan-5-ylamino)but-1-enyl]-methylamino]-N-methylhexanamide |
|---|---|
| PubChem CID | 145460249 |
| Molecular Formula | C24H49N3O2 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 411.38 |
| IUPAC Name | ethane;6-[[(Z)-1-(5-formylnonan-5-ylamino)but-1-enyl]-methylamino]-N-methylhexanamide |
| SMILES | CC.CC/C=C(/NC(C=O)(CCCC)CCCC)N(C)CCCCCC(=O)NC |
| InChI | InChI=1S/C22H43N3O2.C2H6/c1-6-9-16-22(19-26,17-10-7-2)24-20(14-8-3)25(5)18-13-11-12-15-21(27)23-4;1-2/h14,19,24H,6-13,15-18H2,1-5H3,(H,23,27);1-2H3/b20-14-; |
| InChIKey | LRQSICVIPBHRTN-VSOKSMTPSA-N |
| XLogP | 5.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|