C16H17N3O — CID 145460831
(4S)-2-amino-4,6-dimethyl-6-quinolin-6-yl-3,4-dihydropyridin-5-one (PubChem CID 145460831) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is (4S)-2-amino-4,6-dimethyl-6-quinolin-6-yl-3,4-dihydropyridin-5-one.
| Compound Name | (4S)-2-amino-4,6-dimethyl-6-quinolin-6-yl-3,4-dihydropyridin-5-one |
|---|---|
| PubChem CID | 145460831 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (4S)-2-amino-4,6-dimethyl-6-quinolin-6-yl-3,4-dihydropyridin-5-one |
| SMILES | C[C@H]1CC(N)=NC(C)(c2ccc3ncccc3c2)C1=O |
| InChI | InChI=1S/C16H17N3O/c1-10-8-14(17)19-16(2,15(10)20)12-5-6-13-11(9-12)4-3-7-18-13/h3-7,9-10H,8H2,1-2H3,(H2,17,19)/t10-,16?/m0/s1 |
| InChIKey | MZYDZPNSVGQESN-VQVVDHBBSA-N |
| XLogP | 2.42 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |