C13H13N — CID 23238165
8-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline (PubChem CID 23238165) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is 8-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline.
| Compound Name | 8-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline |
|---|---|
| PubChem CID | 23238165 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 8-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline |
| SMILES | CC1CCc2cc3cccnc3cc21 |
| InChI | InChI=1S/C13H13N/c1-9-4-5-10-7-11-3-2-6-14-13(11)8-12(9)10/h2-3,6-9H,4-5H2,1H3 |
| InChIKey | GZJHFIZYEACLFV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |