C31H22N2O3 — CID 14546183
2-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)-phenylmethyl]indene-1,3-dione (PubChem CID 14546183) has the molecular formula C31H22N2O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)-phenylmethyl]indene-1,3-dione.
| Compound Name | 2-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)-phenylmethyl]indene-1,3-dione |
|---|---|
| PubChem CID | 14546183 |
| Molecular Formula | C31H22N2O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 2-[(5-oxo-1,3-diphenyl-4H-pyrazol-4-yl)-phenylmethyl]indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1C(c1ccccc1)C1C(=O)N(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C31H22N2O3/c34-29-23-18-10-11-19-24(23)30(35)27(29)25(20-12-4-1-5-13-20)26-28(21-14-6-2-7-15-21)32-33(31(26)36)22-16-8-3-9-17-22/h1-19,25-27H |
| InChIKey | VIWSLESZBBBPSW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|