C21H32BN5O2 — CID 145461955
CID 145461955 (PubChem CID 145461955) has the molecular formula C21H32BN5O2 and a molecular weight of 397.33 g/mol.
| Compound Name | CID 145461955 |
|---|---|
| PubChem CID | 145461955 |
| Molecular Formula | C21H32BN5O2 |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | — |
| SMILES | [B]C1=CC=CC(NC(=O)N2CCC(CN3C(=O)C(C)(CC(C)C)N=C3N)CC2)C1 |
| InChI | InChI=1S/C21H32BN5O2/c1-14(2)12-21(3)18(28)27(19(23)25-21)13-15-7-9-26(10-8-15)20(29)24-17-6-4-5-16(22)11-17/h4-6,14-15,17H,7-13H2,1-3H3,(H2,23,25)(H,24,29) |
| InChIKey | UCTOOFOWXCISMJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|