About trisodium;4-thiocyanatobenzenethiolate
trisodium;4-thiocyanatobenzenethiolate (PubChem CID 145463025) has the molecular formula C7H4NNa3S2+2
and a molecular weight of 235.22 g/mol. Its IUPAC name is trisodium;4-thiocyanatobenzenethiolate.
Molecular Properties
| Compound Name | trisodium;4-thiocyanatobenzenethiolate |
| PubChem CID | 145463025 |
| Molecular Formula | C7H4NNa3S2+2 |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 234.95 |
| IUPAC Name | trisodium;4-thiocyanatobenzenethiolate |
| SMILES | N#CSc1ccc([S-])cc1.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C7H5NS2.3Na/c8-5-10-7-3-1-6(9)2-4-7;;;/h1-4,9H;;;/q;3*+1/p-1 |
| InChIKey | BUKHJORZHGTEQX-UHFFFAOYSA-M |
| XLogP | -6.82 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | -6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze trisodium;4-thiocyanatobenzenethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;4-thiocyanatobenzenethiolate?
The IUPAC name of trisodium;4-thiocyanatobenzenethiolate (CID 145463025) is trisodium;4-thiocyanatobenzenethiolate.
What is the SMILES notation for trisodium;4-thiocyanatobenzenethiolate?
The canonical SMILES for trisodium;4-thiocyanatobenzenethiolate is N#CSc1ccc([S-])cc1.[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;4-thiocyanatobenzenethiolate?
The InChIKey is BUKHJORZHGTEQX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5NS2.3Na/c8-5-10-7-3-1-6(9)2-4-7;;;/h1-4,9H;;;/q;3*+1/p-1.
What are the key properties of trisodium;4-thiocyanatobenzenethiolate?
trisodium;4-thiocyanatobenzenethiolate has a molecular weight of 235.22 g/mol, XLogP of -6.82, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;4-thiocyanatobenzenethiolate is sourced from PubChem (CID 145463025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).