About (4-methylphenyl) thiocyanate;triphenylphosphane
(4-methylphenyl) thiocyanate;triphenylphosphane (PubChem CID 146308462) has the molecular formula C26H22NPS
and a molecular weight of 411.51 g/mol. Its IUPAC name is (4-methylphenyl) thiocyanate;triphenylphosphane.
Molecular Properties
| Compound Name | (4-methylphenyl) thiocyanate;triphenylphosphane |
| PubChem CID | 146308462 |
| Molecular Formula | C26H22NPS |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (4-methylphenyl) thiocyanate;triphenylphosphane |
| SMILES | Cc1ccc(SC#N)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C8H7NS/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-2-4-8(5-3-7)10-6-9/h1-15H;2-5H,1H3 |
| InChIKey | PUFPSDMVTCRDDI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) thiocyanate;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) thiocyanate;triphenylphosphane?
The IUPAC name of (4-methylphenyl) thiocyanate;triphenylphosphane (CID 146308462) is (4-methylphenyl) thiocyanate;triphenylphosphane.
What is the SMILES notation for (4-methylphenyl) thiocyanate;triphenylphosphane?
The canonical SMILES for (4-methylphenyl) thiocyanate;triphenylphosphane is Cc1ccc(SC#N)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (4-methylphenyl) thiocyanate;triphenylphosphane?
The InChIKey is PUFPSDMVTCRDDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C8H7NS/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-2-4-8(5-3-7)10-6-9/h1-15H;2-5H,1H3.
What are the key properties of (4-methylphenyl) thiocyanate;triphenylphosphane?
(4-methylphenyl) thiocyanate;triphenylphosphane has a molecular weight of 411.51 g/mol, XLogP of 6.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) thiocyanate;triphenylphosphane is sourced from PubChem (CID 146308462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).