About ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane
ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane (PubChem CID 134901624) has the molecular formula C29H26AuP
and a molecular weight of 602.47 g/mol. Its IUPAC name is ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane.
Molecular Properties
| Compound Name | ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane |
| PubChem CID | 134901624 |
| Molecular Formula | C29H26AuP |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane |
| SMILES | Cc1ccc(P(c2ccc(C)cc2)c2ccc(C)cc2)cc1.[Au+].[C-]#Cc1ccccc1 |
| InChI | InChI=1S/C21H21P.C8H5.Au/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;1-2-8-6-4-3-5-7-8;/h4-15H,1-3H3;3-7H;/q;-1;+1 |
| InChIKey | RAEBMERSQXFFKQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane?
The IUPAC name of ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane (CID 134901624) is ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane.
What is the SMILES notation for ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane?
The canonical SMILES for ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane is Cc1ccc(P(c2ccc(C)cc2)c2ccc(C)cc2)cc1.[Au+].[C-]#Cc1ccccc1.
What is the InChIKey of ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane?
The InChIKey is RAEBMERSQXFFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21P.C8H5.Au/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;1-2-8-6-4-3-5-7-8;/h4-15H,1-3H3;3-7H;/q;-1;+1.
What are the key properties of ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane?
ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane has a molecular weight of 602.47 g/mol, XLogP of 5.99, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethynylbenzene;gold(1+);tris(4-methylphenyl)phosphane is sourced from PubChem (CID 134901624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).