About 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane
1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane (PubChem CID 139254816) has the molecular formula C26H24AuP
and a molecular weight of 564.42 g/mol. Its IUPAC name is 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane.
Molecular Properties
| Compound Name | 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane |
| PubChem CID | 139254816 |
| Molecular Formula | C26H24AuP |
| Molecular Weight | 564.42 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane |
| SMILES | Cc1c[c-]cc(C)c1.[Au+].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C8H9.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-4-3-5-8(2)6-7;/h1-15H;4-6H,1-2H3;/q;-1;+1 |
| InChIKey | AETOMDLXYKPFPB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane?
The IUPAC name of 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane (CID 139254816) is 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane.
What is the SMILES notation for 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane?
The canonical SMILES for 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane is Cc1c[c-]cc(C)c1.[Au+].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane?
The InChIKey is AETOMDLXYKPFPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C8H9.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-4-3-5-8(2)6-7;/h1-15H;4-6H,1-2H3;/q;-1;+1.
What are the key properties of 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane?
1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane has a molecular weight of 564.42 g/mol, XLogP of 5.55, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylbenzene-5-ide;gold(1+);triphenylphosphane is sourced from PubChem (CID 139254816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).