C16H30N4O2 — CID 145463354
tert-butyl N-[2-[4-[ethenyl-(methylideneamino)amino]piperidin-1-yl]ethyl]-N-methylcarbamate (PubChem CID 145463354) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[ethenyl-(methylideneamino)amino]piperidin-1-yl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[4-[ethenyl-(methylideneamino)amino]piperidin-1-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 145463354 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | tert-butyl N-[2-[4-[ethenyl-(methylideneamino)amino]piperidin-1-yl]ethyl]-N-methylcarbamate |
| SMILES | C=CN(N=C)C1CCN(CCN(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N4O2/c1-7-20(17-5)14-8-10-19(11-9-14)13-12-18(6)15(21)22-16(2,3)4/h7,14H,1,5,8-13H2,2-4,6H3 |
| InChIKey | KRDQWVPCRLDVHV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|