C15H15NOS — CID 145463664
S-[5-(2-methylphenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine (PubChem CID 145463664) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is S-[5-(2-methylphenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine.
| Compound Name | S-[5-(2-methylphenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 145463664 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | S-[5-(2-methylphenyl)-2,3-dihydro-1-benzofuran-7-yl]thiohydroxylamine |
| SMILES | Cc1ccccc1-c1cc2c(c(SN)c1)OCC2 |
| InChI | InChI=1S/C15H15NOS/c1-10-4-2-3-5-13(10)12-8-11-6-7-17-15(11)14(9-12)18-16/h2-5,8-9H,6-7,16H2,1H3 |
| InChIKey | HQGMIMWZGFWXAZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|