C31H34N2O — CID 145464910
3-ethenyl-N-ethyl-6-[4-[4-[(E)-3-methylpent-3-enyl]phenyl]phenyl]-2-[(Z)-prop-1-enyl]pyridine-4-carboxamide (PubChem CID 145464910) has the molecular formula C31H34N2O and a molecular weight of 450.63 g/mol. Its IUPAC name is 3-ethenyl-N-ethyl-6-[4-[4-[(E)-3-methylpent-3-enyl]phenyl]phenyl]-2-[(Z)-prop-1-enyl]pyridine-4-carboxamide.
| Compound Name | 3-ethenyl-N-ethyl-6-[4-[4-[(E)-3-methylpent-3-enyl]phenyl]phenyl]-2-[(Z)-prop-1-enyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 145464910 |
| Molecular Formula | C31H34N2O |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 3-ethenyl-N-ethyl-6-[4-[4-[(E)-3-methylpent-3-enyl]phenyl]phenyl]-2-[(Z)-prop-1-enyl]pyridine-4-carboxamide |
| SMILES | C=Cc1c(C(=O)NCC)cc(-c2ccc(-c3ccc(CC/C(C)=C/C)cc3)cc2)nc1/C=C\C |
| InChI | InChI=1S/C31H34N2O/c1-6-10-29-27(8-3)28(31(34)32-9-4)21-30(33-29)26-19-17-25(18-20-26)24-15-13-23(14-16-24)12-11-22(5)7-2/h6-8,10,13-21H,3,9,11-12H2,1-2,4-5H3,(H,32,34)/b10-6-,22-7+ |
| InChIKey | DYWUJVNCPBPFQU-CDUQWISNSA-N |
| XLogP | 7.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|