C26H27N3O — CID 145464984
3-ethyl-2-[4-(4-methanimidoylphenyl)phenyl]-N,5-dimethyl-6-[(Z)-prop-1-enyl]pyridine-4-carboxamide (PubChem CID 145464984) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-ethyl-2-[4-(4-methanimidoylphenyl)phenyl]-N,5-dimethyl-6-[(Z)-prop-1-enyl]pyridine-4-carboxamide.
| Compound Name | 3-ethyl-2-[4-(4-methanimidoylphenyl)phenyl]-N,5-dimethyl-6-[(Z)-prop-1-enyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 145464984 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 3-ethyl-2-[4-(4-methanimidoylphenyl)phenyl]-N,5-dimethyl-6-[(Z)-prop-1-enyl]pyridine-4-carboxamide |
| SMILES | [H]/N=C/c1ccc(-c2ccc(-c3nc(/C=C\C)c(C)c(C(=O)NC)c3CC)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O/c1-5-7-23-17(3)24(26(30)28-4)22(6-2)25(29-23)21-14-12-20(13-15-21)19-10-8-18(16-27)9-11-19/h5,7-16,27H,6H2,1-4H3,(H,28,30)/b7-5-,27-16+ |
| InChIKey | YZICPYYODPAQMR-BLHSCRJBSA-N |
| XLogP | 5.68 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|