C25H24N4O4 — CID 145465274
(NE)-N-ethylidenehydroxylamine;N-hydroxy-3-methoxy-2-[4-(4-methylphenyl)phenyl]-1,6-naphthyridine-4-carboxamide (PubChem CID 145465274) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is (NE)-N-ethylidenehydroxylamine;N-hydroxy-3-methoxy-2-[4-(4-methylphenyl)phenyl]-1,6-naphthyridine-4-carboxamide.
| Compound Name | (NE)-N-ethylidenehydroxylamine;N-hydroxy-3-methoxy-2-[4-(4-methylphenyl)phenyl]-1,6-naphthyridine-4-carboxamide |
|---|---|
| PubChem CID | 145465274 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (NE)-N-ethylidenehydroxylamine;N-hydroxy-3-methoxy-2-[4-(4-methylphenyl)phenyl]-1,6-naphthyridine-4-carboxamide |
| SMILES | C/C=N/O.COc1c(-c2ccc(-c3ccc(C)cc3)cc2)nc2ccncc2c1C(=O)NO |
| InChI | InChI=1S/C23H19N3O3.C2H5NO/c1-14-3-5-15(6-4-14)16-7-9-17(10-8-16)21-22(29-2)20(23(27)26-28)18-13-24-12-11-19(18)25-21;1-2-3-4/h3-13,28H,1-2H3,(H,26,27);2,4H,1H3/b;3-2+ |
| InChIKey | DWNWWNYDPPVMCK-ZPYUXNTASA-N |
| XLogP | 4.87 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|