C31H34N2O4 — CID 145465486
N-hydroxy-2-[4-[2-[4-(5-hydroxypentyl)phenyl]ethyl]phenyl]-3-methoxy-6-methylquinoline-4-carboxamide (PubChem CID 145465486) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is N-hydroxy-2-[4-[2-[4-(5-hydroxypentyl)phenyl]ethyl]phenyl]-3-methoxy-6-methylquinoline-4-carboxamide.
| Compound Name | N-hydroxy-2-[4-[2-[4-(5-hydroxypentyl)phenyl]ethyl]phenyl]-3-methoxy-6-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 145465486 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | N-hydroxy-2-[4-[2-[4-(5-hydroxypentyl)phenyl]ethyl]phenyl]-3-methoxy-6-methylquinoline-4-carboxamide |
| SMILES | COc1c(-c2ccc(CCc3ccc(CCCCCO)cc3)cc2)nc2ccc(C)cc2c1C(=O)NO |
| InChI | InChI=1S/C31H34N2O4/c1-21-7-18-27-26(20-21)28(31(35)33-36)30(37-2)29(32-27)25-16-14-24(15-17-25)13-12-23-10-8-22(9-11-23)6-4-3-5-19-34/h7-11,14-18,20,34,36H,3-6,12-13,19H2,1-2H3,(H,33,35) |
| InChIKey | JVBTYHBPYNZHRZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|