C14H20F2N2O2 — CID 145466111
3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane (PubChem CID 145466111) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane.
| Compound Name | 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane |
|---|---|
| PubChem CID | 145466111 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane |
| SMILES | CC.CCCC(N)C(=O)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2O2.C2H6/c1-2-3-10(15)11(17)12(18)16-7-4-5-8(13)9(14)6-7;1-2/h4-6,10H,2-3,15H2,1H3,(H,16,18);1-2H3 |
| InChIKey | RBAAQZVHDPBFHY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|