About 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane
3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane (PubChem CID 145466111) has the molecular formula C14H20F2N2O2
and a molecular weight of 286.32 g/mol. Its IUPAC name is 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane.
Molecular Properties
| Compound Name | 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane |
| PubChem CID | 145466111 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane |
| SMILES | CC.CCCC(N)C(=O)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2O2.C2H6/c1-2-3-10(15)11(17)12(18)16-7-4-5-8(13)9(14)6-7;1-2/h4-6,10H,2-3,15H2,1H3,(H,16,18);1-2H3 |
| InChIKey | RBAAQZVHDPBFHY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane?
The IUPAC name of 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane (CID 145466111) is 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane.
What is the SMILES notation for 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane?
The canonical SMILES for 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane is CC.CCCC(N)C(=O)C(=O)Nc1ccc(F)c(F)c1.
What is the InChIKey of 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane?
The InChIKey is RBAAQZVHDPBFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N2O2.C2H6/c1-2-3-10(15)11(17)12(18)16-7-4-5-8(13)9(14)6-7;1-2/h4-6,10H,2-3,15H2,1H3,(H,16,18);1-2H3.
What are the key properties of 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane?
3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane has a molecular weight of 286.32 g/mol, XLogP of 2.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(3,4-difluorophenyl)-2-oxohexanamide;ethane is sourced from PubChem (CID 145466111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).