C14H11BBr2N2O — CID 145466905
CID 145466905 (PubChem CID 145466905) has the molecular formula C14H11BBr2N2O and a molecular weight of 393.88 g/mol.
| Compound Name | CID 145466905 |
|---|---|
| PubChem CID | 145466905 |
| Molecular Formula | C14H11BBr2N2O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | — |
| SMILES | [B]c1c(C)ccc(Br)c1Nc1ccc(C(=O)CBr)nc1 |
| InChI | InChI=1S/C14H11BBr2N2O/c1-8-2-4-10(17)14(13(8)15)19-9-3-5-11(18-7-9)12(20)6-16/h2-5,7,19H,6H2,1H3 |
| InChIKey | NIXKVAOZGUBIOP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|